C21H31N3O4S — CID 142529684
N-[3-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylsulfamoyl)-2,2-dimethylpropyl]-N-methylacetamide (PubChem CID 142529684) has the molecular formula C21H31N3O4S and a molecular weight of 421.56 g/mol. Its IUPAC name is N-[3-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylsulfamoyl)-2,2-dimethylpropyl]-N-methylacetamide.
| Compound Name | N-[3-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylsulfamoyl)-2,2-dimethylpropyl]-N-methylacetamide |
|---|---|
| PubChem CID | 142529684 |
| Molecular Formula | C21H31N3O4S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N-[3-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylsulfamoyl)-2,2-dimethylpropyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)CC(C)(C)CS(=O)(=O)NC(=O)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C21H31N3O4S/c1-14(25)24(4)12-21(2,3)13-29(27,28)23-20(26)22-19-17-9-5-7-15(17)11-16-8-6-10-18(16)19/h11H,5-10,12-13H2,1-4H3,(H2,22,23,26) |
| InChIKey | TUBAWCNDPHXPPC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |