C19H28KN4O4S — CID 175743982
CID 175743982 (PubChem CID 175743982) has the molecular formula C19H28KN4O4S and a molecular weight of 447.62 g/mol.
| Compound Name | CID 175743982 |
|---|---|
| PubChem CID | 175743982 |
| Molecular Formula | C19H28KN4O4S |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | — |
| SMILES | CC(=O)N(C)CCN(C)S(=O)(=O)NC(=O)Nc1c2c(cc3c1CCC3)CCC2.[K] |
| InChI | InChI=1S/C19H28N4O4S.K/c1-13(24)22(2)10-11-23(3)28(26,27)21-19(25)20-18-16-8-4-6-14(16)12-15-7-5-9-17(15)18;/h12H,4-11H2,1-3H3,(H2,20,21,25); |
| InChIKey | BPJKYHWCQNBIRI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |