C17H21KN5O3S — CID 175710616
CID 175710616 (PubChem CID 175710616) has the molecular formula C17H21KN5O3S and a molecular weight of 414.55 g/mol.
| Compound Name | CID 175710616 |
|---|---|
| PubChem CID | 175710616 |
| Molecular Formula | C17H21KN5O3S |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | — |
| SMILES | CCn1cc(S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)nn1.[K] |
| InChI | InChI=1S/C17H21N5O3S.K/c1-2-22-10-15(19-21-22)26(24,25)20-17(23)18-16-13-7-3-5-11(13)9-12-6-4-8-14(12)16;/h9-10H,2-8H2,1H3,(H2,18,20,23); |
| InChIKey | ADNPXCYCYMYNRZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |