C19H23KN5O3S — CID 175753183
CID 175753183 (PubChem CID 175753183) has the molecular formula C19H23KN5O3S and a molecular weight of 440.59 g/mol.
| Compound Name | CID 175753183 |
|---|---|
| PubChem CID | 175753183 |
| Molecular Formula | C19H23KN5O3S |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | — |
| SMILES | CN(C)c1cncc(S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)n1.[K] |
| InChI | InChI=1S/C19H23N5O3S.K/c1-24(2)16-10-20-11-17(21-16)28(26,27)23-19(25)22-18-14-7-3-5-12(14)9-13-6-4-8-15(13)18;/h9-11H,3-8H2,1-2H3,(H2,22,23,25); |
| InChIKey | OPGUQGHLDWEPTH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |