C23H33N5NaO3S — CID 175825031
CID 175825031 (PubChem CID 175825031) has the molecular formula C23H33N5NaO3S and a molecular weight of 482.61 g/mol.
| Compound Name | CID 175825031 |
|---|---|
| PubChem CID | 175825031 |
| Molecular Formula | C23H33N5NaO3S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | — |
| SMILES | CC(C)n1nc(S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)cc1CCN(C)C.[Na] |
| InChI | InChI=1S/C23H33N5O3S.Na/c1-15(2)28-18(11-12-27(3)4)14-21(25-28)32(30,31)26-23(29)24-22-19-9-5-7-16(19)13-17-8-6-10-20(17)22;/h13-15H,5-12H2,1-4H3,(H2,24,26,29); |
| InChIKey | OREOLSDCYAFWBT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |