C22H29N5NaO3S — CID 175825067
CID 175825067 (PubChem CID 175825067) has the molecular formula C22H29N5NaO3S and a molecular weight of 466.56 g/mol.
| Compound Name | CID 175825067 |
|---|---|
| PubChem CID | 175825067 |
| Molecular Formula | C22H29N5NaO3S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | — |
| SMILES | CC(c1cc(S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)nn1C)N1CCC1.[Na] |
| InChI | InChI=1S/C22H29N5O3S.Na/c1-14(27-10-5-11-27)19-13-20(24-26(19)2)31(29,30)25-22(28)23-21-17-8-3-6-15(17)12-16-7-4-9-18(16)21;/h12-14H,3-11H2,1-2H3,(H2,23,25,28); |
| InChIKey | RXMWLYRMCSWNMF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |