C44H58N10O6S2 — CID 159265974
1-[1-cyclopropyl-5-[(dimethylamino)methyl]pyrazol-3-yl]sulfonyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 159265974) has the molecular formula C44H58N10O6S2 and a molecular weight of 887.15 g/mol. Its IUPAC name is 1-[1-cyclopropyl-5-[(dimethylamino)methyl]pyrazol-3-yl]sulfonyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[1-cyclopropyl-5-[(dimethylamino)methyl]pyrazol-3-yl]sulfonyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 159265974 |
| Molecular Formula | C44H58N10O6S2 |
| Molecular Weight | 887.15 g/mol |
| Exact Mass | 886.40 |
| IUPAC Name | 1-[1-cyclopropyl-5-[(dimethylamino)methyl]pyrazol-3-yl]sulfonyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | CN(C)Cc1cc(S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)nn1C1CC1.CN(C)Cc1cc(S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)nn1C1CC1 |
| InChI | InChI=1S/2C22H29N5O3S/c2*1-26(2)13-17-12-20(24-27(17)16-9-10-16)31(29,30)25-22(28)23-21-18-7-3-5-14(18)11-15-6-4-8-19(15)21/h2*11-12,16H,3-10,13H2,1-2H3,(H2,23,25,28) |
| InChIKey | KXCJYRUSYPIGHL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 192.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.15 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |