C21H25KN5O4S — CID 175753184
CID 175753184 (PubChem CID 175753184) has the molecular formula C21H25KN5O4S and a molecular weight of 482.63 g/mol.
| Compound Name | CID 175753184 |
|---|---|
| PubChem CID | 175753184 |
| Molecular Formula | C21H25KN5O4S |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | — |
| SMILES | O=C(Nc1c2c(cc3c1CCC3)CCC2)NS(=O)(=O)c1cncc(N2CCOCC2)n1.[K] |
| InChI | InChI=1S/C21H25N5O4S.K/c27-21(24-20-16-5-1-3-14(16)11-15-4-2-6-17(15)20)25-31(28,29)19-13-22-12-18(23-19)26-7-9-30-10-8-26;/h11-13H,1-10H2,(H2,24,25,27); |
| InChIKey | GUMWPNITCQEKEX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |