C17H18N4O4S — CID 166572745
1-(6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-ylsulfonyl)-3-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)urea (PubChem CID 166572745) has the molecular formula C17H18N4O4S and a molecular weight of 374.42 g/mol. Its IUPAC name is 1-(6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-ylsulfonyl)-3-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)urea.
| Compound Name | 1-(6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-ylsulfonyl)-3-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)urea |
|---|---|
| PubChem CID | 166572745 |
| Molecular Formula | C17H18N4O4S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 1-(6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-ylsulfonyl)-3-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)urea |
| SMILES | O=C(Nc1c2c(cc3c1CC3)CC2)NS(=O)(=O)c1cc2n(n1)CCOC2 |
| InChI | InChI=1S/C17H18N4O4S/c22-17(18-16-13-3-1-10(13)7-11-2-4-14(11)16)20-26(23,24)15-8-12-9-25-6-5-21(12)19-15/h7-8H,1-6,9H2,(H2,18,20,22) |
| InChIKey | ILQJGOPBNRKOQW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |