C18H25N3O5S2 — CID 156840081
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(E)-3-[methyl(methylsulfonyl)amino]prop-1-enyl]sulfonylurea (PubChem CID 156840081) has the molecular formula C18H25N3O5S2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(E)-3-[methyl(methylsulfonyl)amino]prop-1-enyl]sulfonylurea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(E)-3-[methyl(methylsulfonyl)amino]prop-1-enyl]sulfonylurea |
|---|---|
| PubChem CID | 156840081 |
| Molecular Formula | C18H25N3O5S2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(E)-3-[methyl(methylsulfonyl)amino]prop-1-enyl]sulfonylurea |
| SMILES | CN(C/C=C/S(=O)(=O)NC(=O)Nc1c2c(cc3c1CCC3)CCC2)S(C)(=O)=O |
| InChI | InChI=1S/C18H25N3O5S2/c1-21(27(2,23)24)10-5-11-28(25,26)20-18(22)19-17-15-8-3-6-13(15)12-14-7-4-9-16(14)17/h5,11-12H,3-4,6-10H2,1-2H3,(H2,19,20,22)/b11-5+ |
| InChIKey | XIEJMVJSUXKCAK-VZUCSPMQSA-N |
| XLogP | 1.52 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |