C24H36BrN3O3S — CID 154996682
1-[2-(1,1-diethyl-2-methylpyrrolidin-1-ium-2-yl)ethenylsulfonyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea bromide (PubChem CID 154996682) has the molecular formula C24H36BrN3O3S and a molecular weight of 526.54 g/mol. Its IUPAC name is 1-[2-(1,1-diethyl-2-methylpyrrolidin-1-ium-2-yl)ethenylsulfonyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea bromide.
| Compound Name | 1-[2-(1,1-diethyl-2-methylpyrrolidin-1-ium-2-yl)ethenylsulfonyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea bromide |
|---|---|
| PubChem CID | 154996682 |
| Molecular Formula | C24H36BrN3O3S |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | 1-[2-(1,1-diethyl-2-methylpyrrolidin-1-ium-2-yl)ethenylsulfonyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea bromide |
| SMILES | CC[N+]1(CC)CCCC1(C)C=CS(=O)(=O)NC(=O)Nc1c2c(cc3c1CCC3)CCC2.[Br-] |
| InChI | InChI=1S/C24H35N3O3S.BrH/c1-4-27(5-2)15-8-13-24(27,3)14-16-31(29,30)26-23(28)25-22-20-11-6-9-18(20)17-19-10-7-12-21(19)22;/h14,16-17H,4-13,15H2,1-3H3,(H-,25,26,28);1H |
| InChIKey | ODCRBOKHJUZMFO-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|