C24H35N3O3S — CID 154996926
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(E)-2-[2-methyl-1-(2-methylpropyl)pyrrolidin-2-yl]ethenyl]sulfonylurea (PubChem CID 154996926) has the molecular formula C24H35N3O3S and a molecular weight of 445.63 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(E)-2-[2-methyl-1-(2-methylpropyl)pyrrolidin-2-yl]ethenyl]sulfonylurea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(E)-2-[2-methyl-1-(2-methylpropyl)pyrrolidin-2-yl]ethenyl]sulfonylurea |
|---|---|
| PubChem CID | 154996926 |
| Molecular Formula | C24H35N3O3S |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(E)-2-[2-methyl-1-(2-methylpropyl)pyrrolidin-2-yl]ethenyl]sulfonylurea |
| SMILES | CC(C)CN1CCCC1(C)/C=C/S(=O)(=O)NC(=O)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C24H35N3O3S/c1-17(2)16-27-13-6-11-24(27,3)12-14-31(29,30)26-23(28)25-22-20-9-4-7-18(20)15-19-8-5-10-21(19)22/h12,14-15,17H,4-11,13,16H2,1-3H3,(H2,25,26,28)/b14-12+ |
| InChIKey | DEHGPTYMCGLXHE-WYMLVPIESA-N |
| XLogP | 4.14 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |