C18H22F3N3O5S — CID 175838171
1-[(Z)-3-aminoprop-1-enyl]sulfonyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea;2,2,2-trifluoroacetic acid (PubChem CID 175838171) has the molecular formula C18H22F3N3O5S and a molecular weight of 449.45 g/mol. Its IUPAC name is 1-[(Z)-3-aminoprop-1-enyl]sulfonyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(Z)-3-aminoprop-1-enyl]sulfonyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175838171 |
| Molecular Formula | C18H22F3N3O5S |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 1-[(Z)-3-aminoprop-1-enyl]sulfonyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea;2,2,2-trifluoroacetic acid |
| SMILES | NC/C=C\S(=O)(=O)NC(=O)Nc1c2c(cc3c1CCC3)CCC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H21N3O3S.C2HF3O2/c17-8-3-9-23(21,22)19-16(20)18-15-13-6-1-4-11(13)10-12-5-2-7-14(12)15;3-2(4,5)1(6)7/h3,9-10H,1-2,4-8,17H2,(H2,18,19,20);(H,6,7)/b9-3-; |
| InChIKey | UYPSNVWUYVADQB-WPUSIDMCSA-N |
| XLogP | 2.22 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |