C18H24N3NaO3S — CID 156840068
sodium [(E)-3-(dimethylamino)prop-1-enyl]sulfonyl-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl)azanide (PubChem CID 156840068) has the molecular formula C18H24N3NaO3S and a molecular weight of 385.47 g/mol. Its IUPAC name is sodium [(E)-3-(dimethylamino)prop-1-enyl]sulfonyl-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl)azanide.
| Compound Name | sodium [(E)-3-(dimethylamino)prop-1-enyl]sulfonyl-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl)azanide |
|---|---|
| PubChem CID | 156840068 |
| Molecular Formula | C18H24N3NaO3S |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | sodium [(E)-3-(dimethylamino)prop-1-enyl]sulfonyl-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl)azanide |
| SMILES | CN(C)C/C=C/S(=O)(=O)[N-]C(=O)Nc1c2c(cc3c1CCC3)CCC2.[Na+] |
| InChI | InChI=1S/C18H25N3O3S.Na/c1-21(2)10-5-11-25(23,24)20-18(22)19-17-15-8-3-6-13(15)12-14-7-4-9-16(14)17;/h5,11-12H,3-4,6-10H2,1-2H3,(H2,19,20,22);/q;+1/p-1/b11-5+; |
| InChIKey | XICPGJMHOMZUDC-HMXKFKBXSA-M |
| XLogP | -0.02 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |