C21H23N2NaO4S — CID 155660731
sodium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[(3-methoxyphenyl)methylsulfonyl]azanide (PubChem CID 155660731) has the molecular formula C21H23N2NaO4S and a molecular weight of 422.48 g/mol. Its IUPAC name is sodium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[(3-methoxyphenyl)methylsulfonyl]azanide.
| Compound Name | sodium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[(3-methoxyphenyl)methylsulfonyl]azanide |
|---|---|
| PubChem CID | 155660731 |
| Molecular Formula | C21H23N2NaO4S |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | sodium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[(3-methoxyphenyl)methylsulfonyl]azanide |
| SMILES | COc1cccc(CS(=O)(=O)[N-]C(=O)Nc2c3c(cc4c2CCC4)CCC3)c1.[Na+] |
| InChI | InChI=1S/C21H24N2O4S.Na/c1-27-17-8-2-5-14(11-17)13-28(25,26)23-21(24)22-20-18-9-3-6-15(18)12-16-7-4-10-19(16)20;/h2,5,8,11-12H,3-4,6-7,9-10,13H2,1H3,(H2,22,23,24);/q;+1/p-1 |
| InChIKey | PGPCQEBLIMGQFS-UHFFFAOYSA-M |
| XLogP | 1.11 |
| TPSA | 86.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |