C33H40ClN3O5 — CID 159689199
methyl (2R)-2-amino-3-phenylpropanoate;methyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-3-phenylpropanoate;hydrochloride (PubChem CID 159689199) has the molecular formula C33H40ClN3O5 and a molecular weight of 594.15 g/mol. Its IUPAC name is methyl (2R)-2-amino-3-phenylpropanoate;methyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-3-phenylpropanoate;hydrochloride.
| Compound Name | methyl (2R)-2-amino-3-phenylpropanoate;methyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-3-phenylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 159689199 |
| Molecular Formula | C33H40ClN3O5 |
| Molecular Weight | 594.15 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | methyl (2R)-2-amino-3-phenylpropanoate;methyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-3-phenylpropanoate;hydrochloride |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)NC(=O)Nc1c2c(cc3c1CCC3)CCC2.COC(=O)[C@H](N)Cc1ccccc1.Cl |
| InChI | InChI=1S/C23H26N2O3.C10H13NO2.ClH/c1-28-22(26)20(13-15-7-3-2-4-8-15)24-23(27)25-21-18-11-5-9-16(18)14-17-10-6-12-19(17)21;1-13-10(12)9(11)7-8-5-3-2-4-6-8;/h2-4,7-8,14,20H,5-6,9-13H2,1H3,(H2,24,25,27);2-6,9H,7,11H2,1H3;1H/t20-;9-;/m11./s1 |
| InChIKey | DQAIDGYKIUDZDT-JABPTMLOSA-N |
| XLogP | 4.72 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.15 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |