C28H33N3O3 — CID 163478943
methyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-3-[3-(2-methylidenepyrrolidin-1-yl)phenyl]propanoate (PubChem CID 163478943) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is methyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-3-[3-(2-methylidenepyrrolidin-1-yl)phenyl]propanoate.
| Compound Name | methyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-3-[3-(2-methylidenepyrrolidin-1-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 163478943 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | methyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-3-[3-(2-methylidenepyrrolidin-1-yl)phenyl]propanoate |
| SMILES | C=C1CCCN1c1cccc(C[C@@H](NC(=O)Nc2c3c(cc4c2CCC4)CCC3)C(=O)OC)c1 |
| InChI | InChI=1S/C28H33N3O3/c1-18-7-6-14-31(18)22-11-3-8-19(15-22)16-25(27(32)34-2)29-28(33)30-26-23-12-4-9-20(23)17-21-10-5-13-24(21)26/h3,8,11,15,17,25H,1,4-7,9-10,12-14,16H2,2H3,(H2,29,30,33)/t25-/m1/s1 |
| InChIKey | CCWHBRXEPHXSFK-RUZDIDTESA-N |
| XLogP | 4.68 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |