C17H20N2O5 — CID 146503701
(2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)butanedioic acid (PubChem CID 146503701) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)butanedioic acid.
| Compound Name | (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)butanedioic acid |
|---|---|
| PubChem CID | 146503701 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)butanedioic acid |
| SMILES | O=C(O)C[C@@H](NC(=O)Nc1c2c(cc3c1CCC3)CCC2)C(=O)O |
| InChI | InChI=1S/C17H20N2O5/c20-14(21)8-13(16(22)23)18-17(24)19-15-11-5-1-3-9(11)7-10-4-2-6-12(10)15/h7,13H,1-6,8H2,(H,20,21)(H,22,23)(H2,18,19,24)/t13-/m1/s1 |
| InChIKey | RNURTBCCTSMQCB-CYBMUJFWSA-N |
| XLogP | 1.71 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |