C17H21N3O4 — CID 146503652
4-amino-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-4-oxobutanoic acid (PubChem CID 146503652) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is 4-amino-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-4-oxobutanoic acid.
| Compound Name | 4-amino-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 146503652 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 4-amino-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-4-oxobutanoic acid |
| SMILES | NC(=O)CC(NC(=O)Nc1c2c(cc3c1CCC3)CCC2)C(=O)O |
| InChI | InChI=1S/C17H21N3O4/c18-14(21)8-13(16(22)23)19-17(24)20-15-11-5-1-3-9(11)7-10-4-2-6-12(10)15/h7,13H,1-6,8H2,(H2,18,21)(H,22,23)(H2,19,20,24) |
| InChIKey | RHKUDZDWWMBTOP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |