C23H26N2O4 — CID 146503660
(2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-3-[3-(hydroxymethyl)phenyl]propanoic acid (PubChem CID 146503660) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-3-[3-(hydroxymethyl)phenyl]propanoic acid.
| Compound Name | (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-3-[3-(hydroxymethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 146503660 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-3-[3-(hydroxymethyl)phenyl]propanoic acid |
| SMILES | O=C(Nc1c2c(cc3c1CCC3)CCC2)N[C@H](Cc1cccc(CO)c1)C(=O)O |
| InChI | InChI=1S/C23H26N2O4/c26-13-15-5-1-4-14(10-15)11-20(22(27)28)24-23(29)25-21-18-8-2-6-16(18)12-17-7-3-9-19(17)21/h1,4-5,10,12,20,26H,2-3,6-9,11,13H2,(H,27,28)(H2,24,25,29)/t20-/m1/s1 |
| InChIKey | LBIVGXIRGBOPJY-HXUWFJFHSA-N |
| XLogP | 2.97 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |