C20H20F3N3O3S — CID 130356282
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(2,4,6-trifluorophenyl)methylsulfamoyl]urea (PubChem CID 130356282) has the molecular formula C20H20F3N3O3S and a molecular weight of 439.46 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(2,4,6-trifluorophenyl)methylsulfamoyl]urea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(2,4,6-trifluorophenyl)methylsulfamoyl]urea |
|---|---|
| PubChem CID | 130356282 |
| Molecular Formula | C20H20F3N3O3S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(2,4,6-trifluorophenyl)methylsulfamoyl]urea |
| SMILES | O=C(Nc1c2c(cc3c1CCC3)CCC2)NS(=O)(=O)NCc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C20H20F3N3O3S/c21-13-8-17(22)16(18(23)9-13)10-24-30(28,29)26-20(27)25-19-14-5-1-3-11(14)7-12-4-2-6-15(12)19/h7-9,24H,1-6,10H2,(H2,25,26,27) |
| InChIKey | SKYVYCDGKORYTG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |