C20H18F2N4O2S — CID 146526284
1-[N-cyano-S-(3,5-difluorophenyl)sulfonimidoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 146526284) has the molecular formula C20H18F2N4O2S and a molecular weight of 416.45 g/mol. Its IUPAC name is 1-[N-cyano-S-(3,5-difluorophenyl)sulfonimidoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[N-cyano-S-(3,5-difluorophenyl)sulfonimidoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 146526284 |
| Molecular Formula | C20H18F2N4O2S |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 1-[N-cyano-S-(3,5-difluorophenyl)sulfonimidoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | N#CN=S(=O)(NC(=O)Nc1c2c(cc3c1CCC3)CCC2)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C20H18F2N4O2S/c21-14-8-15(22)10-16(9-14)29(28,24-11-23)26-20(27)25-19-17-5-1-3-12(17)7-13-4-2-6-18(13)19/h7-10H,1-6H2,(H2,24,25,26,27,28) |
| InChIKey | SUSJSQONJMHHMC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|