C24H27N5O3S — CID 142490200
1-[N-cyano-S-(4-morpholin-4-ylphenyl)sulfonimidoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 142490200) has the molecular formula C24H27N5O3S and a molecular weight of 465.58 g/mol. Its IUPAC name is 1-[N-cyano-S-(4-morpholin-4-ylphenyl)sulfonimidoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[N-cyano-S-(4-morpholin-4-ylphenyl)sulfonimidoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 142490200 |
| Molecular Formula | C24H27N5O3S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 1-[N-cyano-S-(4-morpholin-4-ylphenyl)sulfonimidoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | N#CN=S(=O)(NC(=O)Nc1c2c(cc3c1CCC3)CCC2)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H27N5O3S/c25-16-26-33(31,20-9-7-19(8-10-20)29-11-13-32-14-12-29)28-24(30)27-23-21-5-1-3-17(21)15-18-4-2-6-22(18)23/h7-10,15H,1-6,11-14H2,(H2,26,27,28,30,31) |
| InChIKey | KTANEEULANAEBO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 106.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|