C18H17BrN4O2S2 — CID 146526286
1-[S-(5-bromothiophen-2-yl)-N-cyanosulfonimidoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 146526286) has the molecular formula C18H17BrN4O2S2 and a molecular weight of 465.40 g/mol. Its IUPAC name is 1-[S-(5-bromothiophen-2-yl)-N-cyanosulfonimidoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[S-(5-bromothiophen-2-yl)-N-cyanosulfonimidoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 146526286 |
| Molecular Formula | C18H17BrN4O2S2 |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 464.00 |
| IUPAC Name | 1-[S-(5-bromothiophen-2-yl)-N-cyanosulfonimidoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | N#CN=S(=O)(NC(=O)Nc1c2c(cc3c1CCC3)CCC2)c1ccc(Br)s1 |
| InChI | InChI=1S/C18H17BrN4O2S2/c19-15-7-8-16(26-15)27(25,21-10-20)23-18(24)22-17-13-5-1-3-11(13)9-12-4-2-6-14(12)17/h7-9H,1-6H2,(H2,21,22,23,24,25) |
| InChIKey | XTDDNIQXTMQKIQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|