C22H26F2N2O3S2 — CID 161279477
N-[amino-[4-(2-hydroxypropan-2-yl)thiophen-2-yl]-oxo-λ6-sulfanylidene]-2-[8-(difluoromethyl)-1,2,3,5,6,7-hexahydro-s-indacen-4-yl]acetamide (PubChem CID 161279477) has the molecular formula C22H26F2N2O3S2 and a molecular weight of 468.59 g/mol. Its IUPAC name is N-[amino-[4-(2-hydroxypropan-2-yl)thiophen-2-yl]-oxo-λ6-sulfanylidene]-2-[8-(difluoromethyl)-1,2,3,5,6,7-hexahydro-s-indacen-4-yl]acetamide.
| Compound Name | N-[amino-[4-(2-hydroxypropan-2-yl)thiophen-2-yl]-oxo-λ6-sulfanylidene]-2-[8-(difluoromethyl)-1,2,3,5,6,7-hexahydro-s-indacen-4-yl]acetamide |
|---|---|
| PubChem CID | 161279477 |
| Molecular Formula | C22H26F2N2O3S2 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | N-[amino-[4-(2-hydroxypropan-2-yl)thiophen-2-yl]-oxo-λ6-sulfanylidene]-2-[8-(difluoromethyl)-1,2,3,5,6,7-hexahydro-s-indacen-4-yl]acetamide |
| SMILES | CC(C)(O)c1csc(S(N)(=O)=NC(=O)Cc2c3c(c(C(F)F)c4c2CCC4)CCC3)c1 |
| InChI | InChI=1S/C22H26F2N2O3S2/c1-22(2,28)12-9-19(30-11-12)31(25,29)26-18(27)10-17-13-5-3-7-15(13)20(21(23)24)16-8-4-6-14(16)17/h9,11,21,28H,3-8,10H2,1-2H3,(H2,25,26,27,29) |
| InChIKey | VEWTVUGGURIXSV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |