C21H25F2N3O4S2 — CID 157087051
N-[amino-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-2-[8-(difluoromethoxy)-1,2,3,5,6,7-hexahydro-s-indacen-4-yl]acetamide (PubChem CID 157087051) has the molecular formula C21H25F2N3O4S2 and a molecular weight of 485.58 g/mol. Its IUPAC name is N-[amino-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-2-[8-(difluoromethoxy)-1,2,3,5,6,7-hexahydro-s-indacen-4-yl]acetamide.
| Compound Name | N-[amino-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-2-[8-(difluoromethoxy)-1,2,3,5,6,7-hexahydro-s-indacen-4-yl]acetamide |
|---|---|
| PubChem CID | 157087051 |
| Molecular Formula | C21H25F2N3O4S2 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | N-[amino-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-2-[8-(difluoromethoxy)-1,2,3,5,6,7-hexahydro-s-indacen-4-yl]acetamide |
| SMILES | CC(C)(O)c1ncc(S(N)(=O)=NC(=O)Cc2c3c(c(OC(F)F)c4c2CCC4)CCC3)s1 |
| InChI | InChI=1S/C21H25F2N3O4S2/c1-21(2,28)19-25-10-17(31-19)32(24,29)26-16(27)9-15-11-5-3-7-13(11)18(30-20(22)23)14-8-4-6-12(14)15/h10,20,28H,3-9H2,1-2H3,(H2,24,26,27,29) |
| InChIKey | AEFDRWCWJXJFCM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |