C38H60N2O2 — CID 46217208
3-[(dibutylamino)methyl]-1-[3-[(dibutylamino)methyl]-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 46217208) has the molecular formula C38H60N2O2 and a molecular weight of 576.91 g/mol. Its IUPAC name is 3-[(dibutylamino)methyl]-1-[3-[(dibutylamino)methyl]-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 3-[(dibutylamino)methyl]-1-[3-[(dibutylamino)methyl]-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 46217208 |
| Molecular Formula | C38H60N2O2 |
| Molecular Weight | 576.91 g/mol |
| Exact Mass | 576.47 |
| IUPAC Name | 3-[(dibutylamino)methyl]-1-[3-[(dibutylamino)methyl]-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | CCCCN(CCCC)Cc1cc2c(c(-c3c(O)c(CN(CCCC)CCCC)cc4c3CCCC4)c1O)CCCC2 |
| InChI | InChI=1S/C38H60N2O2/c1-5-9-21-39(22-10-6-2)27-31-25-29-17-13-15-19-33(29)35(37(31)41)36-34-20-16-14-18-30(34)26-32(38(36)42)28-40(23-11-7-3)24-12-8-4/h25-26,41-42H,5-24,27-28H2,1-4H3 |
| InChIKey | PJXQEDWIQBXPPH-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.91 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|