C24H46N4 — CID 139658926
4,6-bis[(dibutylamino)methyl]benzene-1,3-diamine (PubChem CID 139658926) has the molecular formula C24H46N4 and a molecular weight of 390.66 g/mol. Its IUPAC name is 4,6-bis[(dibutylamino)methyl]benzene-1,3-diamine.
| Compound Name | 4,6-bis[(dibutylamino)methyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 139658926 |
| Molecular Formula | C24H46N4 |
| Molecular Weight | 390.66 g/mol |
| Exact Mass | 390.37 |
| IUPAC Name | 4,6-bis[(dibutylamino)methyl]benzene-1,3-diamine |
| SMILES | CCCCN(CCCC)Cc1cc(CN(CCCC)CCCC)c(N)cc1N |
| InChI | InChI=1S/C24H46N4/c1-5-9-13-27(14-10-6-2)19-21-17-22(24(26)18-23(21)25)20-28(15-11-7-3)16-12-8-4/h17-18H,5-16,19-20,25-26H2,1-4H3 |
| InChIKey | PEMWJWQGAYMMIO-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.66 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|