C16H30N4 — CID 25223449
2-N,4-N-dibutyl-2-N,4-N-dimethylbenzene-1,2,4,5-tetramine (PubChem CID 25223449) has the molecular formula C16H30N4 and a molecular weight of 278.44 g/mol. Its IUPAC name is 2-N,4-N-dibutyl-2-N,4-N-dimethylbenzene-1,2,4,5-tetramine.
| Compound Name | 2-N,4-N-dibutyl-2-N,4-N-dimethylbenzene-1,2,4,5-tetramine |
|---|---|
| PubChem CID | 25223449 |
| Molecular Formula | C16H30N4 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | 2-N,4-N-dibutyl-2-N,4-N-dimethylbenzene-1,2,4,5-tetramine |
| SMILES | CCCCN(C)c1cc(N(C)CCCC)c(N)cc1N |
| InChI | InChI=1S/C16H30N4/c1-5-7-9-19(3)15-12-16(14(18)11-13(15)17)20(4)10-8-6-2/h11-12H,5-10,17-18H2,1-4H3 |
| InChIKey | SOBYGTMKRHTMLZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|