C12H19IN2 — CID 66065676
4-iodo-1-N-methyl-1-N-pentylbenzene-1,2-diamine (PubChem CID 66065676) has the molecular formula C12H19IN2 and a molecular weight of 318.20 g/mol. Its IUPAC name is 4-iodo-1-N-methyl-1-N-pentylbenzene-1,2-diamine.
| Compound Name | 4-iodo-1-N-methyl-1-N-pentylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 66065676 |
| Molecular Formula | C12H19IN2 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 4-iodo-1-N-methyl-1-N-pentylbenzene-1,2-diamine |
| SMILES | CCCCCN(C)c1ccc(I)cc1N |
| InChI | InChI=1S/C12H19IN2/c1-3-4-5-8-15(2)12-7-6-10(13)9-11(12)14/h6-7,9H,3-5,8,14H2,1-2H3 |
| InChIKey | ZNLPFEXENUGQRU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|