About 3-N-butyl-3-N-methylpyridine-3,4-diamine;methanamine
3-N-butyl-3-N-methylpyridine-3,4-diamine;methanamine (PubChem CID 143837442) has the molecular formula C11H22N4
and a molecular weight of 210.32 g/mol. Its IUPAC name is 3-N-butyl-3-N-methylpyridine-3,4-diamine;methanamine.
Molecular Properties
| Compound Name | 3-N-butyl-3-N-methylpyridine-3,4-diamine;methanamine |
| PubChem CID | 143837442 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | 3-N-butyl-3-N-methylpyridine-3,4-diamine;methanamine |
| SMILES | CCCCN(C)c1cnccc1N.CN |
| InChI | InChI=1S/C10H17N3.CH5N/c1-3-4-7-13(2)10-8-12-6-5-9(10)11;1-2/h5-6,8H,3-4,7H2,1-2H3,(H2,11,12);2H2,1H3 |
| InChIKey | PGBWUEKZUBXOFY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-N-butyl-3-N-methylpyridine-3,4-diamine;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-butyl-3-N-methylpyridine-3,4-diamine;methanamine?
The IUPAC name of 3-N-butyl-3-N-methylpyridine-3,4-diamine;methanamine (CID 143837442) is 3-N-butyl-3-N-methylpyridine-3,4-diamine;methanamine.
What is the SMILES notation for 3-N-butyl-3-N-methylpyridine-3,4-diamine;methanamine?
The canonical SMILES for 3-N-butyl-3-N-methylpyridine-3,4-diamine;methanamine is CCCCN(C)c1cnccc1N.CN.
What is the InChIKey of 3-N-butyl-3-N-methylpyridine-3,4-diamine;methanamine?
The InChIKey is PGBWUEKZUBXOFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3.CH5N/c1-3-4-7-13(2)10-8-12-6-5-9(10)11;1-2/h5-6,8H,3-4,7H2,1-2H3,(H2,11,12);2H2,1H3.
What are the key properties of 3-N-butyl-3-N-methylpyridine-3,4-diamine;methanamine?
3-N-butyl-3-N-methylpyridine-3,4-diamine;methanamine has a molecular weight of 210.32 g/mol, XLogP of 1.48, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-butyl-3-N-methylpyridine-3,4-diamine;methanamine is sourced from PubChem (CID 143837442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).