C15H25NO2 — CID 15553610
3-[(dibutylamino)methyl]benzene-1,2-diol (PubChem CID 15553610) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 3-[(dibutylamino)methyl]benzene-1,2-diol.
| Compound Name | 3-[(dibutylamino)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 15553610 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 3-[(dibutylamino)methyl]benzene-1,2-diol |
| SMILES | CCCCN(CCCC)Cc1cccc(O)c1O |
| InChI | InChI=1S/C15H25NO2/c1-3-5-10-16(11-6-4-2)12-13-8-7-9-14(17)15(13)18/h7-9,17-18H,3-6,10-12H2,1-2H3 |
| InChIKey | PKLFMKPBYUVLKH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|