C31H36N2O5 — CID 177101921
[2-oxo-2-[3-[4-[4-[4-(phenylmethoxycarbonylamino)butyl]phenyl]phenyl]propylamino]ethyl] acetate (PubChem CID 177101921) has the molecular formula C31H36N2O5 and a molecular weight of 516.64 g/mol. Its IUPAC name is [2-oxo-2-[3-[4-[4-[4-(phenylmethoxycarbonylamino)butyl]phenyl]phenyl]propylamino]ethyl] acetate.
| Compound Name | [2-oxo-2-[3-[4-[4-[4-(phenylmethoxycarbonylamino)butyl]phenyl]phenyl]propylamino]ethyl] acetate |
|---|---|
| PubChem CID | 177101921 |
| Molecular Formula | C31H36N2O5 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | [2-oxo-2-[3-[4-[4-[4-(phenylmethoxycarbonylamino)butyl]phenyl]phenyl]propylamino]ethyl] acetate |
| SMILES | CC(=O)OCC(=O)NCCCc1ccc(-c2ccc(CCCCNC(=O)OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H36N2O5/c1-24(34)37-23-30(35)32-21-7-11-26-14-18-29(19-15-26)28-16-12-25(13-17-28)8-5-6-20-33-31(36)38-22-27-9-3-2-4-10-27/h2-4,9-10,12-19H,5-8,11,20-23H2,1H3,(H,32,35)(H,33,36) |
| InChIKey | AAPDMJXTMFWINS-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|