C21H30BFN2O3 — CID 170516843
1-[2-[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,7-diazaspiro[3.5]nonan-7-yl]ethanone (PubChem CID 170516843) has the molecular formula C21H30BFN2O3 and a molecular weight of 388.29 g/mol. Its IUPAC name is 1-[2-[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,7-diazaspiro[3.5]nonan-7-yl]ethanone.
| Compound Name | 1-[2-[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,7-diazaspiro[3.5]nonan-7-yl]ethanone |
|---|---|
| PubChem CID | 170516843 |
| Molecular Formula | C21H30BFN2O3 |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 1-[2-[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,7-diazaspiro[3.5]nonan-7-yl]ethanone |
| SMILES | CC(=O)N1CCC2(CC1)CN(c1cccc(B3OC(C)(C)C(C)(C)O3)c1F)C2 |
| InChI | InChI=1S/C21H30BFN2O3/c1-15(26)24-11-9-21(10-12-24)13-25(14-21)17-8-6-7-16(18(17)23)22-27-19(2,3)20(4,5)28-22/h6-8H,9-14H2,1-5H3 |
| InChIKey | FICPAGOAGYGZKR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|