C15H23BN2O3S — CID 164643981
cis-(1R,2R)-2-ethyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]cyclopropane-1-carboxamide (PubChem CID 164643981) has the molecular formula C15H23BN2O3S and a molecular weight of 322.24 g/mol. Its IUPAC name is cis-(1R,2R)-2-ethyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]cyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2R)-2-ethyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 164643981 |
| Molecular Formula | C15H23BN2O3S |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | cis-(1R,2R)-2-ethyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]cyclopropane-1-carboxamide |
| SMILES | CC[C@@H]1C[C@H]1C(=O)Nc1ncc(B2OC(C)(C)C(C)(C)O2)s1 |
| InChI | InChI=1S/C15H23BN2O3S/c1-6-9-7-10(9)12(19)18-13-17-8-11(22-13)16-20-14(2,3)15(4,5)21-16/h8-10H,6-7H2,1-5H3,(H,17,18,19)/t9-,10-/m1/s1 |
| InChIKey | OKWBWTXEPXFKHH-NXEZZACHSA-N |
| XLogP | 2.43 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|