C14H23BN2O4S — CID 66687428
tert-butyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamic acid (PubChem CID 66687428) has the molecular formula C14H23BN2O4S and a molecular weight of 326.23 g/mol. Its IUPAC name is tert-butyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamic acid.
| Compound Name | tert-butyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamic acid |
|---|---|
| PubChem CID | 66687428 |
| Molecular Formula | C14H23BN2O4S |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | tert-butyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)c1ncc(B2OC(C)(C)C(C)(C)O2)s1 |
| InChI | InChI=1S/C14H23BN2O4S/c1-12(2,3)17(11(18)19)10-16-8-9(22-10)15-20-13(4,5)14(6,7)21-15/h8H,1-7H3,(H,18,19) |
| InChIKey | IYWBHOZZVURZFW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|