C17H29BN2O4S — CID 58688452
tert-butyl N-propan-2-yl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamate (PubChem CID 58688452) has the molecular formula C17H29BN2O4S and a molecular weight of 368.31 g/mol. Its IUPAC name is tert-butyl N-propan-2-yl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamate.
| Compound Name | tert-butyl N-propan-2-yl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 58688452 |
| Molecular Formula | C17H29BN2O4S |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | tert-butyl N-propan-2-yl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamate |
| SMILES | CC(C)N(C(=O)OC(C)(C)C)c1ncc(B2OC(C)(C)C(C)(C)O2)s1 |
| InChI | InChI=1S/C17H29BN2O4S/c1-11(2)20(14(21)22-15(3,4)5)13-19-10-12(25-13)18-23-16(6,7)17(8,9)24-18/h10-11H,1-9H3 |
| InChIKey | YQHNYCPEFFIMMT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|