About Tert-butyl 5-bromothiazol-2-yl(isopropyl)carbamate
Tert-butyl 5-bromothiazol-2-yl(isopropyl)carbamate (PubChem CID 58688351) has the molecular formula C11H17BrN2O2S
and a molecular weight of 321.24 g/mol. Its IUPAC name is tert-butyl N-(5-bromo-1,3-thiazol-2-yl)-N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | Tert-butyl 5-bromothiazol-2-yl(isopropyl)carbamate |
| PubChem CID | 58688351 |
| Molecular Formula | C11H17BrN2O2S |
| Molecular Weight | 321.24 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | tert-butyl N-(5-bromo-1,3-thiazol-2-yl)-N-propan-2-ylcarbamate |
| SMILES | CC(C)N(C1=NC=C(S1)Br)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H17BrN2O2S/c1-7(2)14(9-13-6-8(12)17-9)10(15)16-11(3,4)5/h6-7H,1-5H3 |
| InChIKey | LQLHUMILSVQBCA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 70.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | 281 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.24 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Tert-butyl 5-bromothiazol-2-yl(isopropyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tert-butyl 5-bromothiazol-2-yl(isopropyl)carbamate?
The IUPAC name of Tert-butyl 5-bromothiazol-2-yl(isopropyl)carbamate (CID 58688351) is tert-butyl N-(5-bromo-1,3-thiazol-2-yl)-N-propan-2-ylcarbamate.
What is the SMILES notation for Tert-butyl 5-bromothiazol-2-yl(isopropyl)carbamate?
The canonical SMILES for Tert-butyl 5-bromothiazol-2-yl(isopropyl)carbamate is CC(C)N(C1=NC=C(S1)Br)C(=O)OC(C)(C)C.
What is the InChIKey of Tert-butyl 5-bromothiazol-2-yl(isopropyl)carbamate?
The InChIKey is LQLHUMILSVQBCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17BrN2O2S/c1-7(2)14(9-13-6-8(12)17-9)10(15)16-11(3,4)5/h6-7H,1-5H3.
What are the key properties of Tert-butyl 5-bromothiazol-2-yl(isopropyl)carbamate?
Tert-butyl 5-bromothiazol-2-yl(isopropyl)carbamate has a molecular weight of 321.24 g/mol, XLogP of 3.90, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Tert-butyl 5-bromothiazol-2-yl(isopropyl)carbamate is sourced from PubChem (CID 58688351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).