C17H29BN2O4S — CID 66607494
[5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]-(2,3,3-trimethylbutan-2-yl)carbamic acid (PubChem CID 66607494) has the molecular formula C17H29BN2O4S and a molecular weight of 368.30 g/mol. Its IUPAC name is [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]-(2,3,3-trimethylbutan-2-yl)carbamic acid.
| Compound Name | [5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]-(2,3,3-trimethylbutan-2-yl)carbamic acid |
|---|---|
| PubChem CID | 66607494 |
| Molecular Formula | C17H29BN2O4S |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]-(2,3,3-trimethylbutan-2-yl)carbamic acid |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(S2)N(C(=O)O)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H29BN2O4S/c1-14(2,3)15(4,5)20(13(21)22)12-19-10-11(25-12)18-23-16(6,7)17(8,9)24-18/h10H,1-9H3,(H,21,22) |
| InChIKey | UACOWTFZRRWXSF-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 100.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | 517 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|