C12H20BNO3S — CID 86731681
2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]propan-2-ol (PubChem CID 86731681) has the molecular formula C12H20BNO3S and a molecular weight of 269.17 g/mol. Its IUPAC name is 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]propan-2-ol.
| Compound Name | 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 86731681 |
| Molecular Formula | C12H20BNO3S |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]propan-2-ol |
| SMILES | CC(C)(O)c1ncc(B2OC(C)(C)C(C)(C)O2)s1 |
| InChI | InChI=1S/C12H20BNO3S/c1-10(2,15)9-14-7-8(18-9)13-16-11(3,4)12(5,6)17-13/h7,15H,1-6H3 |
| InChIKey | IWGJDWAQIMTREH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|