C9H15BN2O3S — CID 130053615
N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]hydroxylamine (PubChem CID 130053615) has the molecular formula C9H15BN2O3S and a molecular weight of 242.11 g/mol. Its IUPAC name is N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]hydroxylamine.
| Compound Name | N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 130053615 |
| Molecular Formula | C9H15BN2O3S |
| Molecular Weight | 242.11 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]hydroxylamine |
| SMILES | CC1(C)OB(c2cnc(NO)s2)OC1(C)C |
| InChI | InChI=1S/C9H15BN2O3S/c1-8(2)9(3,4)15-10(14-8)6-5-11-7(12-13)16-6/h5,13H,1-4H3,(H,11,12) |
| InChIKey | LJBPKKDJGRDBTC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.11 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|