C18H32BN3O2 — CID 171059297
N,N-bis(2-methylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine (PubChem CID 171059297) has the molecular formula C18H32BN3O2 and a molecular weight of 333.29 g/mol. Its IUPAC name is N,N-bis(2-methylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine.
| Compound Name | N,N-bis(2-methylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 171059297 |
| Molecular Formula | C18H32BN3O2 |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.26 |
| IUPAC Name | N,N-bis(2-methylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
| SMILES | CC(C)CN(CC(C)C)c1ncc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C18H32BN3O2/c1-13(2)11-22(12-14(3)4)16-20-9-15(10-21-16)19-23-17(5,6)18(7,8)24-19/h9-10,13-14H,11-12H2,1-8H3 |
| InChIKey | FQYYNDLBPDNRSG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|