C15H23BClN3O3 — CID 71632764
2-chloro-N-propan-2-yl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]acetamide (PubChem CID 71632764) has the molecular formula C15H23BClN3O3 and a molecular weight of 339.63 g/mol. Its IUPAC name is 2-chloro-N-propan-2-yl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]acetamide.
| Compound Name | 2-chloro-N-propan-2-yl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]acetamide |
|---|---|
| PubChem CID | 71632764 |
| Molecular Formula | C15H23BClN3O3 |
| Molecular Weight | 339.63 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-chloro-N-propan-2-yl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]acetamide |
| SMILES | CC(C)N(C(=O)CCl)c1ncc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C15H23BClN3O3/c1-10(2)20(12(21)7-17)13-18-8-11(9-19-13)16-22-14(3,4)15(5,6)23-16/h8-10H,7H2,1-6H3 |
| InChIKey | ASBDXURCTMPCHB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.63 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|