C14H22BN3O5 — CID 99867889
(2R)-2,3-dihydroxy-N-methyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]propanamide (PubChem CID 99867889) has the molecular formula C14H22BN3O5 and a molecular weight of 323.16 g/mol. Its IUPAC name is (2R)-2,3-dihydroxy-N-methyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]propanamide.
| Compound Name | (2R)-2,3-dihydroxy-N-methyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]propanamide |
|---|---|
| PubChem CID | 99867889 |
| Molecular Formula | C14H22BN3O5 |
| Molecular Weight | 323.16 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | (2R)-2,3-dihydroxy-N-methyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]propanamide |
| SMILES | CN(C(=O)[C@H](O)CO)c1ncc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C14H22BN3O5/c1-13(2)14(3,4)23-15(22-13)9-6-16-12(17-7-9)18(5)11(21)10(20)8-19/h6-7,10,19-20H,8H2,1-5H3/t10-/m1/s1 |
| InChIKey | JSEYVWCTLMAWKV-SNVBAGLBSA-N |
| XLogP | -0.91 |
| TPSA | 105.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.16 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|