C23H29BN2O6S — CID 57493901
N-[(4-methoxyphenyl)methyl]-N-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzoxazol-3-yl]methyl]methanesulfonamide (PubChem CID 57493901) has the molecular formula C23H29BN2O6S and a molecular weight of 472.37 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-N-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzoxazol-3-yl]methyl]methanesulfonamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-N-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzoxazol-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 57493901 |
| Molecular Formula | C23H29BN2O6S |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-N-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzoxazol-3-yl]methyl]methanesulfonamide |
| SMILES | COc1ccc(CN(Cc2noc3cc(B4OC(C)(C)C(C)(C)O4)ccc23)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C23H29BN2O6S/c1-22(2)23(3,4)32-24(31-22)17-9-12-19-20(25-30-21(19)13-17)15-26(33(6,27)28)14-16-7-10-18(29-5)11-8-16/h7-13H,14-15H2,1-6H3 |
| InChIKey | NAMYOLUCQUFZGC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 91.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|