C29H30BN3O3 — CID 91440014
2-[3-[(4-methoxyphenyl)methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoindol-1-yl]-1H-benzimidazole (PubChem CID 91440014) has the molecular formula C29H30BN3O3 and a molecular weight of 479.39 g/mol. Its IUPAC name is 2-[3-[(4-methoxyphenyl)methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoindol-1-yl]-1H-benzimidazole.
| Compound Name | 2-[3-[(4-methoxyphenyl)methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoindol-1-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 91440014 |
| Molecular Formula | C29H30BN3O3 |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 2-[3-[(4-methoxyphenyl)methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoindol-1-yl]-1H-benzimidazole |
| SMILES | COc1ccc(Cc2[nH]c(-c3nc4ccccc4[nH]3)c3cc(B4OC(C)(C)C(C)(C)O4)ccc23)cc1 |
| InChI | InChI=1S/C29H30BN3O3/c1-28(2)29(3,4)36-30(35-28)19-12-15-21-22(17-19)26(27-32-23-8-6-7-9-24(23)33-27)31-25(21)16-18-10-13-20(34-5)14-11-18/h6-15,17,31H,16H2,1-5H3,(H,32,33) |
| InChIKey | OJJGRXUZQXGMKO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 72.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|