C19H19BF2N2O2 — CID 168554651
2-[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-benzimidazole (PubChem CID 168554651) has the molecular formula C19H19BF2N2O2 and a molecular weight of 356.18 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-benzimidazole.
| Compound Name | 2-[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 168554651 |
| Molecular Formula | C19H19BF2N2O2 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-benzimidazole |
| SMILES | CC1(C)OB(c2c(F)cc(-c3nc4ccccc4[nH]3)cc2F)OC1(C)C |
| InChI | InChI=1S/C19H19BF2N2O2/c1-18(2)19(3,4)26-20(25-18)16-12(21)9-11(10-13(16)22)17-23-14-7-5-6-8-15(14)24-17/h5-10H,1-4H3,(H,23,24) |
| InChIKey | QYHUXBOMWRSQGO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|