C14H11FN2O — CID 168555763
[4-(1H-benzimidazol-2-yl)-2-fluorophenyl]methanol (PubChem CID 168555763) has the molecular formula C14H11FN2O and a molecular weight of 242.25 g/mol. Its IUPAC name is [4-(1H-benzimidazol-2-yl)-2-fluorophenyl]methanol.
| Compound Name | [4-(1H-benzimidazol-2-yl)-2-fluorophenyl]methanol |
|---|---|
| PubChem CID | 168555763 |
| Molecular Formula | C14H11FN2O |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | [4-(1H-benzimidazol-2-yl)-2-fluorophenyl]methanol |
| SMILES | OCc1ccc(-c2nc3ccccc3[nH]2)cc1F |
| InChI | InChI=1S/C14H11FN2O/c15-11-7-9(5-6-10(11)8-18)14-16-12-3-1-2-4-13(12)17-14/h1-7,18H,8H2,(H,16,17) |
| InChIKey | QQKVPYAFBOZVAZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |