C20H22FN3 — CID 168553765
2-[3-fluoro-4-[(4-methylpiperidin-1-yl)methyl]phenyl]-1H-benzimidazole (PubChem CID 168553765) has the molecular formula C20H22FN3 and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-[3-fluoro-4-[(4-methylpiperidin-1-yl)methyl]phenyl]-1H-benzimidazole.
| Compound Name | 2-[3-fluoro-4-[(4-methylpiperidin-1-yl)methyl]phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 168553765 |
| Molecular Formula | C20H22FN3 |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 2-[3-fluoro-4-[(4-methylpiperidin-1-yl)methyl]phenyl]-1H-benzimidazole |
| SMILES | CC1CCN(Cc2ccc(-c3nc4ccccc4[nH]3)cc2F)CC1 |
| InChI | InChI=1S/C20H22FN3/c1-14-8-10-24(11-9-14)13-16-7-6-15(12-17(16)21)20-22-18-4-2-3-5-19(18)23-20/h2-7,12,14H,8-11,13H2,1H3,(H,22,23) |
| InChIKey | LOGGRWQOTBGGAH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |