C15H13NO2 — CID 91419468
3-[(4-methoxyphenyl)methyl]-1,2-benzoxazole (PubChem CID 91419468) has the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methyl]-1,2-benzoxazole.
| Compound Name | 3-[(4-methoxyphenyl)methyl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 91419468 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 3-[(4-methoxyphenyl)methyl]-1,2-benzoxazole |
| SMILES | COc1ccc(Cc2noc3ccccc23)cc1 |
| InChI | InChI=1S/C15H13NO2/c1-17-12-8-6-11(7-9-12)10-14-13-4-2-3-5-15(13)18-16-14/h2-9H,10H2,1H3 |
| InChIKey | VYEBENUHCOMXJZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |